C18H23N3OS — CID 95329588
2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfanyl]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 95329588) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfanyl]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | 2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfanyl]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 95329588 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfanyl]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1NC(=O)CS[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C18H23N3OS/c1-12-18(13(2)21(3)20-12)19-17(22)11-23-16-10-6-8-14-7-4-5-9-15(14)16/h4-5,7,9,16H,6,8,10-11H2,1-3H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | WUCPTBSLTLQBML-INIZCTEOSA-N |
| XLogP | 3.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |