C18H24N4O — CID 95329757
N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine (PubChem CID 95329757) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 95329757 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
| SMILES | CCc1nnc2n1C[C@@H](CNCc1ccc3c(c1)CCO3)CC2 |
| InChI | InChI=1S/C18H24N4O/c1-2-17-20-21-18-6-4-14(12-22(17)18)11-19-10-13-3-5-16-15(9-13)7-8-23-16/h3,5,9,14,19H,2,4,6-8,10-12H2,1H3/t14-/m1/s1 |
| InChIKey | OZERKOKVBBVINW-CQSZACIVSA-N |
| XLogP | 2.13 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|