C15H18N4O — CID 95330155
(E)-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pent-2-enamide (PubChem CID 95330155) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is (E)-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pent-2-enamide.
| Compound Name | (E)-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pent-2-enamide |
|---|---|
| PubChem CID | 95330155 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (E)-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pent-2-enamide |
| SMILES | CC/C=C/C(=O)N[C@@H](C)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C15H18N4O/c1-3-4-5-15(20)18-12(2)13-6-8-14(9-7-13)19-11-16-10-17-19/h4-12H,3H2,1-2H3,(H,18,20)/b5-4+/t12-/m0/s1 |
| InChIKey | MKMFNORBAWEPOT-ITKZLYELSA-N |
| XLogP | 2.41 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|