C11H21F3N2O2 — CID 95332225
N,N-dimethyl-1-[(2S)-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholin-2-yl]methanamine (PubChem CID 95332225) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2S)-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholin-2-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[(2S)-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 95332225 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | N,N-dimethyl-1-[(2S)-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholin-2-yl]methanamine |
| SMILES | CN(C)C[C@H]1CN(CCOCC(F)(F)F)CCO1 |
| InChI | InChI=1S/C11H21F3N2O2/c1-15(2)7-10-8-16(4-6-18-10)3-5-17-9-11(12,13)14/h10H,3-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | AXBDTKRTLVLUIA-JTQLQIEISA-N |
| XLogP | 0.83 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|