C20H31N3O2 — CID 95332942
1-(2,3-dihydroindol-1-yl)-2-[(3R)-4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]ethanone (PubChem CID 95332942) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-[(3R)-4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]ethanone.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-[(3R)-4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 95332942 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-[(3R)-4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]ethanone |
| SMILES | CCOCCN1CCN(CC(=O)N2CCc3ccccc32)C[C@H]1CC |
| InChI | InChI=1S/C20H31N3O2/c1-3-18-15-21(11-12-22(18)13-14-25-4-2)16-20(24)23-10-9-17-7-5-6-8-19(17)23/h5-8,18H,3-4,9-16H2,1-2H3/t18-/m1/s1 |
| InChIKey | IDXZDTCCJKSLNE-GOSISDBHSA-N |
| XLogP | 2.01 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|