C16H22FN3O4 — CID 95334225
N-[2-(dimethylamino)ethyl]-2-fluoro-4-nitro-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 95334225) has the molecular formula C16H22FN3O4 and a molecular weight of 339.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-fluoro-4-nitro-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-fluoro-4-nitro-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 95334225 |
| Molecular Formula | C16H22FN3O4 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-fluoro-4-nitro-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | CN(C)CCN(C[C@@H]1CCCO1)C(=O)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C16H22FN3O4/c1-18(2)7-8-19(11-13-4-3-9-24-13)16(21)14-6-5-12(20(22)23)10-15(14)17/h5-6,10,13H,3-4,7-9,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZGNXAGSGKMJDHL-ZDUSSCGKSA-N |
| XLogP | 1.92 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|