About methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate
methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate (PubChem CID 95334331) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate |
| PubChem CID | 95334331 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate |
| SMILES | COC(=O)NC(=O)CN[C@@H]1CCCC[C@H]1C(C)(C)C |
| InChI | InChI=1S/C14H26N2O3/c1-14(2,3)10-7-5-6-8-11(10)15-9-12(17)16-13(18)19-4/h10-11,15H,5-9H2,1-4H3,(H,16,17,18)/t10-,11-/m1/s1 |
| InChIKey | LIADUYNWTKQLJT-GHMZBOCLSA-N |
| XLogP | 2.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate?
The IUPAC name of methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate (CID 95334331) is methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate.
What is the SMILES notation for methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate?
The canonical SMILES for methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate is COC(=O)NC(=O)CN[C@@H]1CCCC[C@H]1C(C)(C)C.
What is the InChIKey of methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate?
The InChIKey is LIADUYNWTKQLJT-GHMZBOCLSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-14(2,3)10-7-5-6-8-11(10)15-9-12(17)16-13(18)19-4/h10-11,15H,5-9H2,1-4H3,(H,16,17,18)/t10-,11-/m1/s1.
What are the key properties of methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate?
methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate has a molecular weight of 270.37 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-[[(1R,2S)-2-tert-butylcyclohexyl]amino]acetyl]carbamate is sourced from PubChem (CID 95334331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).