About N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide
N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 95336275) has the molecular formula C14H21N5OS
and a molecular weight of 307.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 95336275 |
| Molecular Formula | C14H21N5OS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | C[C@@H](Cn1cccn1)NCc1csc(CC(=O)N(C)C)n1 |
| InChI | InChI=1S/C14H21N5OS/c1-11(9-19-6-4-5-16-19)15-8-12-10-21-13(17-12)7-14(20)18(2)3/h4-6,10-11,15H,7-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | WEZBVBVHERVVSP-NSHDSACASA-N |
| XLogP | 1.15 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide (CID 95336275) is N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide is C[C@@H](Cn1cccn1)NCc1csc(CC(=O)N(C)C)n1.
What is the InChIKey of N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide?
The InChIKey is WEZBVBVHERVVSP-NSHDSACASA-N. The full InChI is InChI=1S/C14H21N5OS/c1-11(9-19-6-4-5-16-19)15-8-12-10-21-13(17-12)7-14(20)18(2)3/h4-6,10-11,15H,7-9H2,1-3H3/t11-/m0/s1.
What are the key properties of N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide?
N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide has a molecular weight of 307.42 g/mol, XLogP of 1.15, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-[4-[[[(2S)-1-pyrazol-1-ylpropan-2-yl]amino]methyl]-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 95336275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).