C16H24ClN3O2 — CID 95336812
N-[(1R)-1-(4-chlorophenyl)ethyl]-2-[[(2R)-4-methylmorpholin-2-yl]methylamino]acetamide (PubChem CID 95336812) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-2-[[(2R)-4-methylmorpholin-2-yl]methylamino]acetamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-[[(2R)-4-methylmorpholin-2-yl]methylamino]acetamide |
|---|---|
| PubChem CID | 95336812 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-[[(2R)-4-methylmorpholin-2-yl]methylamino]acetamide |
| SMILES | C[C@@H](NC(=O)CNC[C@@H]1CN(C)CCO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-12(13-3-5-14(17)6-4-13)19-16(21)10-18-9-15-11-20(2)7-8-22-15/h3-6,12,15,18H,7-11H2,1-2H3,(H,19,21)/t12-,15-/m1/s1 |
| InChIKey | QJUZWNOIIQJOLH-IUODEOHRSA-N |
| XLogP | 1.44 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |