C16H19FN6 — CID 95336823
(6R)-N-[(1-ethyl-5-fluorobenzimidazol-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95336823) has the molecular formula C16H19FN6 and a molecular weight of 314.37 g/mol. Its IUPAC name is (6R)-N-[(1-ethyl-5-fluorobenzimidazol-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[(1-ethyl-5-fluorobenzimidazol-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95336823 |
| Molecular Formula | C16H19FN6 |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (6R)-N-[(1-ethyl-5-fluorobenzimidazol-2-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CCn1c(CN[C@@H]2CCc3ncnn3C2)nc2cc(F)ccc21 |
| InChI | InChI=1S/C16H19FN6/c1-2-22-14-5-3-11(17)7-13(14)21-16(22)8-18-12-4-6-15-19-10-20-23(15)9-12/h3,5,7,10,12,18H,2,4,6,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | NTVMWWOEYHIVEV-GFCCVEGCSA-N |
| XLogP | 1.89 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |