C28H28ClN5O2 — CID 95337841
(2R)-3-chloro-2-(3,5-dimethylpyrazol-1-yl)-N,N-bis[(5-phenyl-1,3-oxazol-2-yl)methyl]propan-1-amine (PubChem CID 95337841) has the molecular formula C28H28ClN5O2 and a molecular weight of 502.02 g/mol. Its IUPAC name is (2R)-3-chloro-2-(3,5-dimethylpyrazol-1-yl)-N,N-bis[(5-phenyl-1,3-oxazol-2-yl)methyl]propan-1-amine.
| Compound Name | (2R)-3-chloro-2-(3,5-dimethylpyrazol-1-yl)-N,N-bis[(5-phenyl-1,3-oxazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 95337841 |
| Molecular Formula | C28H28ClN5O2 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (2R)-3-chloro-2-(3,5-dimethylpyrazol-1-yl)-N,N-bis[(5-phenyl-1,3-oxazol-2-yl)methyl]propan-1-amine |
| SMILES | Cc1cc(C)n([C@@H](CCl)CN(Cc2ncc(-c3ccccc3)o2)Cc2ncc(-c3ccccc3)o2)n1 |
| InChI | InChI=1S/C28H28ClN5O2/c1-20-13-21(2)34(32-20)24(14-29)17-33(18-27-30-15-25(35-27)22-9-5-3-6-10-22)19-28-31-16-26(36-28)23-11-7-4-8-12-23/h3-13,15-16,24H,14,17-19H2,1-2H3/t24-/m0/s1 |
| InChIKey | YVPROUSVMYZKSA-DEOSSOPVSA-N |
| XLogP | 6.29 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|