C24H29N5O — CID 95337868
(2S)-2-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-N-phenylazepane-1-carboxamide (PubChem CID 95337868) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is (2S)-2-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-N-phenylazepane-1-carboxamide.
| Compound Name | (2S)-2-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-N-phenylazepane-1-carboxamide |
|---|---|
| PubChem CID | 95337868 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (2S)-2-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-N-phenylazepane-1-carboxamide |
| SMILES | N#Cc1cccnc1N1CCC([C@@H]2CCCCCN2C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N5O/c25-18-20-8-7-14-26-23(20)28-16-12-19(13-17-28)22-11-5-2-6-15-29(22)24(30)27-21-9-3-1-4-10-21/h1,3-4,7-10,14,19,22H,2,5-6,11-13,15-17H2,(H,27,30)/t22-/m0/s1 |
| InChIKey | CACHCKOCJLIBTD-QFIPXVFZSA-N |
| XLogP | 4.65 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |