C10H10F3N3O5 — CID 95338449
(2R)-4-(2,4-dinitroanilino)-1,1,1-trifluorobutan-2-ol (PubChem CID 95338449) has the molecular formula C10H10F3N3O5 and a molecular weight of 309.20 g/mol. Its IUPAC name is (2R)-4-(2,4-dinitroanilino)-1,1,1-trifluorobutan-2-ol.
| Compound Name | (2R)-4-(2,4-dinitroanilino)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 95338449 |
| Molecular Formula | C10H10F3N3O5 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2R)-4-(2,4-dinitroanilino)-1,1,1-trifluorobutan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(NCC[C@@H](O)C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10F3N3O5/c11-10(12,13)9(17)3-4-14-7-2-1-6(15(18)19)5-8(7)16(20)21/h1-2,5,9,14,17H,3-4H2/t9-/m1/s1 |
| InChIKey | GCPFDSCKLXGTRO-SECBINFHSA-N |
| XLogP | 2.23 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|