C17H24N4O2 — CID 95339473
2,4,6-trimethyl-5-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 95339473) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 2,4,6-trimethyl-5-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 2,4,6-trimethyl-5-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 95339473 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2,4,6-trimethyl-5-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cc1nc2[nH]n(C)c(=O)c2c(C)c1CC(=O)N1CCC[C@H](C)C1 |
| InChI | InChI=1S/C17H24N4O2/c1-10-6-5-7-21(9-10)14(22)8-13-11(2)15-16(18-12(13)3)19-20(4)17(15)23/h10H,5-9H2,1-4H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | BWPIUENNXCPVJP-JTQLQIEISA-N |
| XLogP | 1.68 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|