C18H27N3O2S — CID 95339617
(2R)-1-[3-[(3-cyclopropylthiophene-2-carbonyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 95339617) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (2R)-1-[3-[(3-cyclopropylthiophene-2-carbonyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[3-[(3-cyclopropylthiophene-2-carbonyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95339617 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (2R)-1-[3-[(3-cyclopropylthiophene-2-carbonyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CCCN1CCCNC(=O)c1sccc1C1CC1 |
| InChI | InChI=1S/C18H27N3O2S/c1-20(2)18(23)15-5-3-10-21(15)11-4-9-19-17(22)16-14(8-12-24-16)13-6-7-13/h8,12-13,15H,3-7,9-11H2,1-2H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | UUPDRMUKDRDCBP-OAHLLOKOSA-N |
| XLogP | 2.30 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|