About 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one
1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one (PubChem CID 95341693) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one.
Molecular Properties
| Compound Name | 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one |
| PubChem CID | 95341693 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one |
| SMILES | C[C@H]([C@@H](C)NCCC(=O)N1CCOCC1)n1cccn1 |
| InChI | InChI=1S/C14H24N4O2/c1-12(13(2)18-7-3-5-16-18)15-6-4-14(19)17-8-10-20-11-9-17/h3,5,7,12-13,15H,4,6,8-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | WWHPYIIWBHVEBL-CHWSQXEVSA-N |
| XLogP | 0.67 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one?
The IUPAC name of 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one (CID 95341693) is 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one.
What is the SMILES notation for 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one?
The canonical SMILES for 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one is C[C@H]([C@@H](C)NCCC(=O)N1CCOCC1)n1cccn1.
What is the InChIKey of 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one?
The InChIKey is WWHPYIIWBHVEBL-CHWSQXEVSA-N. The full InChI is InChI=1S/C14H24N4O2/c1-12(13(2)18-7-3-5-16-18)15-6-4-14(19)17-8-10-20-11-9-17/h3,5,7,12-13,15H,4,6,8-11H2,1-2H3/t12-,13-/m1/s1.
What are the key properties of 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one?
1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one has a molecular weight of 280.37 g/mol, XLogP of 0.67, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-yl-3-[[(2R,3R)-3-pyrazol-1-ylbutan-2-yl]amino]propan-1-one is sourced from PubChem (CID 95341693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).