C20H25N3O2 — CID 95343180
[4-(cyclopropylmethoxy)phenyl]-[(3R)-3-(2-methylimidazol-1-yl)piperidin-1-yl]methanone (PubChem CID 95343180) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is [4-(cyclopropylmethoxy)phenyl]-[(3R)-3-(2-methylimidazol-1-yl)piperidin-1-yl]methanone.
| Compound Name | [4-(cyclopropylmethoxy)phenyl]-[(3R)-3-(2-methylimidazol-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95343180 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | [4-(cyclopropylmethoxy)phenyl]-[(3R)-3-(2-methylimidazol-1-yl)piperidin-1-yl]methanone |
| SMILES | Cc1nccn1[C@@H]1CCCN(C(=O)c2ccc(OCC3CC3)cc2)C1 |
| InChI | InChI=1S/C20H25N3O2/c1-15-21-10-12-23(15)18-3-2-11-22(13-18)20(24)17-6-8-19(9-7-17)25-14-16-4-5-16/h6-10,12,16,18H,2-5,11,13-14H2,1H3/t18-/m1/s1 |
| InChIKey | AVMKYBSWYBZGCH-GOSISDBHSA-N |
| XLogP | 3.46 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |