C27H30N4O4 — CID 95343423
N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-4-(phenylcarbamoylamino)benzamide (PubChem CID 95343423) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-4-(phenylcarbamoylamino)benzamide.
| Compound Name | N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-4-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 95343423 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-4-(phenylcarbamoylamino)benzamide |
| SMILES | COc1ccc([C@@H](CNC(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H30N4O4/c1-34-24-13-9-20(10-14-24)25(31-15-17-35-18-16-31)19-28-26(32)21-7-11-23(12-8-21)30-27(33)29-22-5-3-2-4-6-22/h2-14,25H,15-19H2,1H3,(H,28,32)(H2,29,30,33)/t25-/m1/s1 |
| InChIKey | SRDPFDFZLDJAPQ-RUZDIDTESA-N |
| XLogP | 4.14 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |