C14H26N4O3 — CID 95344088
1-[2-[(3R)-3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]acetyl]imidazolidin-2-one (PubChem CID 95344088) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[2-[(3R)-3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]acetyl]imidazolidin-2-one.
| Compound Name | 1-[2-[(3R)-3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]acetyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 95344088 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-[2-[(3R)-3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]acetyl]imidazolidin-2-one |
| SMILES | CC[C@@H]1CN(CC(=O)N2CCNC2=O)CCN1CCOC |
| InChI | InChI=1S/C14H26N4O3/c1-3-12-10-16(6-7-17(12)8-9-21-2)11-13(19)18-5-4-15-14(18)20/h12H,3-11H2,1-2H3,(H,15,20)/t12-/m1/s1 |
| InChIKey | XKEBPQTWNXZYEB-GFCCVEGCSA-N |
| XLogP | -0.42 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |