C15H20FN3O — CID 95344628
4-fluoro-3-[[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 95344628) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is 4-fluoro-3-[[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-fluoro-3-[[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 95344628 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 4-fluoro-3-[[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | C[C@H](O)CN1CCN(Cc2cc(C#N)ccc2F)CC1 |
| InChI | InChI=1S/C15H20FN3O/c1-12(20)10-18-4-6-19(7-5-18)11-14-8-13(9-17)2-3-15(14)16/h2-3,8,12,20H,4-7,10-11H2,1H3/t12-/m0/s1 |
| InChIKey | PECAJBXGZJQCHC-LBPRGKRZSA-N |
| XLogP | 1.20 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |