C16H22N6OS — CID 95345224
N,N-bis(cyanomethyl)-3-[(3S)-3-methyl-4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]propanamide (PubChem CID 95345224) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-3-[(3S)-3-methyl-4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]propanamide.
| Compound Name | N,N-bis(cyanomethyl)-3-[(3S)-3-methyl-4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 95345224 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N,N-bis(cyanomethyl)-3-[(3S)-3-methyl-4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]propanamide |
| SMILES | Cc1csc(N2CCN(CCC(=O)N(CC#N)CC#N)C[C@@H]2C)n1 |
| InChI | InChI=1S/C16H22N6OS/c1-13-12-24-16(19-13)22-10-9-20(11-14(22)2)6-3-15(23)21(7-4-17)8-5-18/h12,14H,3,6-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | GMESCSAPOIVPFI-AWEZNQCLSA-N |
| XLogP | 1.23 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|