C13H20F3N3OS — CID 95345942
4-methyl-2-[(2S)-2-methyl-4-[2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]-1,3-thiazole (PubChem CID 95345942) has the molecular formula C13H20F3N3OS and a molecular weight of 323.38 g/mol. Its IUPAC name is 4-methyl-2-[(2S)-2-methyl-4-[2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]-1,3-thiazole.
| Compound Name | 4-methyl-2-[(2S)-2-methyl-4-[2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 95345942 |
| Molecular Formula | C13H20F3N3OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-methyl-2-[(2S)-2-methyl-4-[2-(2,2,2-trifluoroethoxy)ethyl]piperazin-1-yl]-1,3-thiazole |
| SMILES | Cc1csc(N2CCN(CCOCC(F)(F)F)C[C@@H]2C)n1 |
| InChI | InChI=1S/C13H20F3N3OS/c1-10-8-21-12(17-10)19-4-3-18(7-11(19)2)5-6-20-9-13(14,15)16/h8,11H,3-7,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | VKPWTTOHEINZGZ-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|