C16H18FN5O2 — CID 95347777
1-[(3S)-1-(3-fluorophenyl)-2-oxopiperidin-3-yl]-3-(1H-pyrazol-5-ylmethyl)urea (PubChem CID 95347777) has the molecular formula C16H18FN5O2 and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-[(3S)-1-(3-fluorophenyl)-2-oxopiperidin-3-yl]-3-(1H-pyrazol-5-ylmethyl)urea.
| Compound Name | 1-[(3S)-1-(3-fluorophenyl)-2-oxopiperidin-3-yl]-3-(1H-pyrazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 95347777 |
| Molecular Formula | C16H18FN5O2 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[(3S)-1-(3-fluorophenyl)-2-oxopiperidin-3-yl]-3-(1H-pyrazol-5-ylmethyl)urea |
| SMILES | O=C(NCc1ccn[nH]1)N[C@H]1CCCN(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C16H18FN5O2/c17-11-3-1-4-13(9-11)22-8-2-5-14(15(22)23)20-16(24)18-10-12-6-7-19-21-12/h1,3-4,6-7,9,14H,2,5,8,10H2,(H,19,21)(H2,18,20,24)/t14-/m0/s1 |
| InChIKey | AEOAZTBTRFLJQB-AWEZNQCLSA-N |
| XLogP | 1.54 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |