C21H20N2O3 — CID 95347863
cis-(1S,2R)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-2-pyridin-3-ylcyclopropane-1-carboxamide (PubChem CID 95347863) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is cis-(1S,2R)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-2-pyridin-3-ylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-2-pyridin-3-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95347863 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | cis-(1S,2R)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-2-pyridin-3-ylcyclopropane-1-carboxamide |
| SMILES | O=C([C@H]1C[C@H]1c1cccnc1)N(Cc1ccco1)Cc1ccccc1O |
| InChI | InChI=1S/C21H20N2O3/c24-20-8-2-1-5-16(20)13-23(14-17-7-4-10-26-17)21(25)19-11-18(19)15-6-3-9-22-12-15/h1-10,12,18-19,24H,11,13-14H2/t18-,19-/m0/s1 |
| InChIKey | PPOPCODETVKEFA-OALUTQOASA-N |
| XLogP | 3.71 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|