C18H33N3OS — CID 95348894
(2S)-N-cyclohexyl-2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]pyrrolidine-1-carbothioamide (PubChem CID 95348894) has the molecular formula C18H33N3OS and a molecular weight of 339.55 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]pyrrolidine-1-carbothioamide.
| Compound Name | (2S)-N-cyclohexyl-2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 95348894 |
| Molecular Formula | C18H33N3OS |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]pyrrolidine-1-carbothioamide |
| SMILES | C[C@@H]1CN(C[C@@H]2CCCN2C(=S)NC2CCCCC2)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H33N3OS/c1-14-11-20(12-15(2)22-14)13-17-9-6-10-21(17)18(23)19-16-7-4-3-5-8-16/h14-17H,3-13H2,1-2H3,(H,19,23)/t14-,15-,17+/m1/s1 |
| InChIKey | VTIVBCUKAMMNFY-INMHGKMJSA-N |
| XLogP | 2.77 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|