C13H15F3N4OS — CID 95349086
5,7-dimethyl-2-[(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 95349086) has the molecular formula C13H15F3N4OS and a molecular weight of 332.35 g/mol. Its IUPAC name is 5,7-dimethyl-2-[(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5,7-dimethyl-2-[(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 95349086 |
| Molecular Formula | C13H15F3N4OS |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 5,7-dimethyl-2-[(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl]sulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2nc(S[C@@H]([C@H]3CCCO3)C(F)(F)F)nc2n1 |
| InChI | InChI=1S/C13H15F3N4OS/c1-7-6-8(2)20-11(17-7)18-12(19-20)22-10(13(14,15)16)9-4-3-5-21-9/h6,9-10H,3-5H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | FREYOKHTCABJEQ-ZJUUUORDSA-N |
| XLogP | 2.94 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |