C19H22F3N5O2S — CID 95349591
(4S)-3-[5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carbonyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 95349591) has the molecular formula C19H22F3N5O2S and a molecular weight of 441.48 g/mol. Its IUPAC name is (4S)-3-[5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carbonyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-3-[5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carbonyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95349591 |
| Molecular Formula | C19H22F3N5O2S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (4S)-3-[5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carbonyl]-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)N2CSC[C@@H]2C(=O)NCC(F)(F)F)nn1-c1ccccc1C(C)C |
| InChI | InChI=1S/C19H22F3N5O2S/c1-11(2)13-6-4-5-7-14(13)27-12(3)24-16(25-27)18(29)26-10-30-8-15(26)17(28)23-9-19(20,21)22/h4-7,11,15H,8-10H2,1-3H3,(H,23,28)/t15-/m1/s1 |
| InChIKey | UABBDOSGSTXNGB-OAHLLOKOSA-N |
| XLogP | 2.89 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |