C15H18N6S — CID 95350882
N-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 95350882) has the molecular formula C15H18N6S and a molecular weight of 314.42 g/mol. Its IUPAC name is N-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 95350882 |
| Molecular Formula | C15H18N6S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)c1nc2n(n1)C[C@H](Nc1ncnc3sccc13)CC2 |
| InChI | InChI=1S/C15H18N6S/c1-9(2)13-19-12-4-3-10(7-21(12)20-13)18-14-11-5-6-22-15(11)17-8-16-14/h5-6,8-10H,3-4,7H2,1-2H3,(H,16,17,18)/t10-/m1/s1 |
| InChIKey | KCRGURYUVVQQCV-SNVBAGLBSA-N |
| XLogP | 2.83 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |