C14H18ClFN2O2 — CID 95351618
(5-chloro-2-fluorophenyl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone (PubChem CID 95351618) has the molecular formula C14H18ClFN2O2 and a molecular weight of 300.76 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95351618 |
| Molecular Formula | C14H18ClFN2O2 |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone |
| SMILES | C[C@@H](O)CN1CCN(C(=O)c2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C14H18ClFN2O2/c1-10(19)9-17-4-6-18(7-5-17)14(20)12-8-11(15)2-3-13(12)16/h2-3,8,10,19H,4-7,9H2,1H3/t10-/m1/s1 |
| InChIKey | IDMCHLZBURAHDP-SNVBAGLBSA-N |
| XLogP | 1.62 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |