About 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole
2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole (PubChem CID 95351742) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole |
| PubChem CID | 95351742 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole |
| SMILES | COCCN1CCN(Cc2nc3ccccc3o2)C[C@@H]1C |
| InChI | InChI=1S/C16H23N3O2/c1-13-11-18(7-8-19(13)9-10-20-2)12-16-17-14-5-3-4-6-15(14)21-16/h3-6,13H,7-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | SQHCJCXZIDEFDT-ZDUSSCGKSA-N |
| XLogP | 1.98 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole?
The IUPAC name of 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole (CID 95351742) is 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole?
The canonical SMILES for 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole is COCCN1CCN(Cc2nc3ccccc3o2)C[C@@H]1C.
What is the InChIKey of 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole?
The InChIKey is SQHCJCXZIDEFDT-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-13-11-18(7-8-19(13)9-10-20-2)12-16-17-14-5-3-4-6-15(14)21-16/h3-6,13H,7-12H2,1-2H3/t13-/m0/s1.
What are the key properties of 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole?
2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole has a molecular weight of 289.38 g/mol, XLogP of 1.98, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]methyl]-1,3-benzoxazole is sourced from PubChem (CID 95351742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).