C14H23N5 — CID 95352436
4-[(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]butanenitrile (PubChem CID 95352436) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-[(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]butanenitrile.
| Compound Name | 4-[(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 95352436 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 4-[(2S)-2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]butanenitrile |
| SMILES | Cc1nc(C)n(C[C@@H]2CCCCN2CCCC#N)n1 |
| InChI | InChI=1S/C14H23N5/c1-12-16-13(2)19(17-12)11-14-7-3-5-9-18(14)10-6-4-8-15/h14H,3-7,9-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | RHUFWOGHZXQZHD-AWEZNQCLSA-N |
| XLogP | 2.05 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|