C21H21ClN2O2 — CID 95352964
(4S)-1-(3-chlorophenyl)-4-[(2R)-2-phenylpyrrolidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 95352964) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is (4S)-1-(3-chlorophenyl)-4-[(2R)-2-phenylpyrrolidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4S)-1-(3-chlorophenyl)-4-[(2R)-2-phenylpyrrolidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 95352964 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (4S)-1-(3-chlorophenyl)-4-[(2R)-2-phenylpyrrolidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1C[C@H](C(=O)N2CCC[C@@H]2c2ccccc2)CN1c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21ClN2O2/c22-17-8-4-9-18(13-17)24-14-16(12-20(24)25)21(26)23-11-5-10-19(23)15-6-2-1-3-7-15/h1-4,6-9,13,16,19H,5,10-12,14H2/t16-,19+/m0/s1 |
| InChIKey | KTUWBWUNVMHASP-QFBILLFUSA-N |
| XLogP | 4.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |