About [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate
[(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate (PubChem CID 95353246) has the molecular formula C17H16O4S2
and a molecular weight of 348.45 g/mol. Its IUPAC name is [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate.
Molecular Properties
| Compound Name | [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate |
| PubChem CID | 95353246 |
| Molecular Formula | C17H16O4S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate |
| SMILES | C[C@H]1C[C@@H](OC(=O)c2ccccc2SCc2ccsc2)C(=O)O1 |
| InChI | InChI=1S/C17H16O4S2/c1-11-8-14(17(19)20-11)21-16(18)13-4-2-3-5-15(13)23-10-12-6-7-22-9-12/h2-7,9,11,14H,8,10H2,1H3/t11-,14+/m0/s1 |
| InChIKey | BGTDIQSLNNWKSZ-SMDDNHRTSA-N |
| XLogP | 3.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate?
The IUPAC name of [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate (CID 95353246) is [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate.
What is the SMILES notation for [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate?
The canonical SMILES for [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate is C[C@H]1C[C@@H](OC(=O)c2ccccc2SCc2ccsc2)C(=O)O1.
What is the InChIKey of [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate?
The InChIKey is BGTDIQSLNNWKSZ-SMDDNHRTSA-N. The full InChI is InChI=1S/C17H16O4S2/c1-11-8-14(17(19)20-11)21-16(18)13-4-2-3-5-15(13)23-10-12-6-7-22-9-12/h2-7,9,11,14H,8,10H2,1H3/t11-,14+/m0/s1.
What are the key properties of [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate?
[(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate has a molecular weight of 348.45 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 2-(thiophen-3-ylmethylsulfanyl)benzoate is sourced from PubChem (CID 95353246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).