C18H29N3O3 — CID 95353394
N,N-diethyl-4-[[(2R,3R)-2-hydroxy-3-methylpentyl]carbamoylamino]benzamide (PubChem CID 95353394) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is N,N-diethyl-4-[[(2R,3R)-2-hydroxy-3-methylpentyl]carbamoylamino]benzamide.
| Compound Name | N,N-diethyl-4-[[(2R,3R)-2-hydroxy-3-methylpentyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 95353394 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N,N-diethyl-4-[[(2R,3R)-2-hydroxy-3-methylpentyl]carbamoylamino]benzamide |
| SMILES | CC[C@@H](C)[C@@H](O)CNC(=O)Nc1ccc(C(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C18H29N3O3/c1-5-13(4)16(22)12-19-18(24)20-15-10-8-14(9-11-15)17(23)21(6-2)7-3/h8-11,13,16,22H,5-7,12H2,1-4H3,(H2,19,20,24)/t13-,16+/m1/s1 |
| InChIKey | TUGDTFCZZAAJOA-CJNGLKHVSA-N |
| XLogP | 2.70 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |