About (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol
(2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol (PubChem CID 95353403) has the molecular formula C15H27N5O
and a molecular weight of 293.41 g/mol. Its IUPAC name is (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol |
| PubChem CID | 95353403 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol |
| SMILES | Cc1cc(N2CCN(C[C@H](O)C(C)(C)C)CC2)nc(N)n1 |
| InChI | InChI=1S/C15H27N5O/c1-11-9-13(18-14(16)17-11)20-7-5-19(6-8-20)10-12(21)15(2,3)4/h9,12,21H,5-8,10H2,1-4H3,(H2,16,17,18)/t12-/m0/s1 |
| InChIKey | HCUXLESADQBQQD-LBPRGKRZSA-N |
| XLogP | 0.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol?
The IUPAC name of (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol (CID 95353403) is (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol.
What is the SMILES notation for (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol?
The canonical SMILES for (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol is Cc1cc(N2CCN(C[C@H](O)C(C)(C)C)CC2)nc(N)n1.
What is the InChIKey of (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol?
The InChIKey is HCUXLESADQBQQD-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H27N5O/c1-11-9-13(18-14(16)17-11)20-7-5-19(6-8-20)10-12(21)15(2,3)4/h9,12,21H,5-8,10H2,1-4H3,(H2,16,17,18)/t12-/m0/s1.
What are the key properties of (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol?
(2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol has a molecular weight of 293.41 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-3,3-dimethylbutan-2-ol is sourced from PubChem (CID 95353403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).