About 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide
4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide (PubChem CID 95353416) has the molecular formula C17H21FN2O3
and a molecular weight of 320.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide |
| PubChem CID | 95353416 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide |
| SMILES | C[C@H]1C[C@H]1C(=O)NNC(=O)C1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C17H21FN2O3/c1-11-10-14(11)15(21)19-20-16(22)17(6-8-23-9-7-17)12-2-4-13(18)5-3-12/h2-5,11,14H,6-10H2,1H3,(H,19,21)(H,20,22)/t11-,14+/m0/s1 |
| InChIKey | KMFDUZJDEXAKLV-SMDDNHRTSA-N |
| XLogP | 1.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide?
The IUPAC name of 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide (CID 95353416) is 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide.
What is the SMILES notation for 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide?
The canonical SMILES for 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide is C[C@H]1C[C@H]1C(=O)NNC(=O)C1(c2ccc(F)cc2)CCOCC1.
What is the InChIKey of 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide?
The InChIKey is KMFDUZJDEXAKLV-SMDDNHRTSA-N. The full InChI is InChI=1S/C17H21FN2O3/c1-11-10-14(11)15(21)19-20-16(22)17(6-8-23-9-7-17)12-2-4-13(18)5-3-12/h2-5,11,14H,6-10H2,1H3,(H,19,21)(H,20,22)/t11-,14+/m0/s1.
What are the key properties of 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide?
4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide has a molecular weight of 320.36 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-N'-[(1R,2S)-2-methylcyclopropanecarbonyl]oxane-4-carbohydrazide is sourced from PubChem (CID 95353416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).