C19H24FN3O2 — CID 95353507
3-(3-fluoro-4-methoxyphenyl)-1-[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-1-one (PubChem CID 95353507) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-(3-fluoro-4-methoxyphenyl)-1-[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-(3-fluoro-4-methoxyphenyl)-1-[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95353507 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 3-(3-fluoro-4-methoxyphenyl)-1-[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CCCC[C@@H]2Cn2cccn2)cc1F |
| InChI | InChI=1S/C19H24FN3O2/c1-25-18-8-6-15(13-17(18)20)7-9-19(24)23-12-3-2-5-16(23)14-22-11-4-10-21-22/h4,6,8,10-11,13,16H,2-3,5,7,9,12,14H2,1H3/t16-/m1/s1 |
| InChIKey | AOICQLZOPFCUAS-MRXNPFEDSA-N |
| XLogP | 3.04 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |