C17H33N3O3 — CID 95353955
1-butyl-3-[(2S)-1-[4-(hydroxymethyl)piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]urea (PubChem CID 95353955) has the molecular formula C17H33N3O3 and a molecular weight of 327.47 g/mol. Its IUPAC name is 1-butyl-3-[(2S)-1-[4-(hydroxymethyl)piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]urea.
| Compound Name | 1-butyl-3-[(2S)-1-[4-(hydroxymethyl)piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 95353955 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | 1-butyl-3-[(2S)-1-[4-(hydroxymethyl)piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]urea |
| SMILES | CCCCNC(=O)N[C@@H](CC(C)C)C(=O)N1CCC(CO)CC1 |
| InChI | InChI=1S/C17H33N3O3/c1-4-5-8-18-17(23)19-15(11-13(2)3)16(22)20-9-6-14(12-21)7-10-20/h13-15,21H,4-12H2,1-3H3,(H2,18,19,23)/t15-/m0/s1 |
| InChIKey | QELREUWCIDMPDD-HNNXBMFYSA-N |
| XLogP | 1.73 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|