C19H23N5O — CID 95354595
1-[(3S)-1-methylpiperidin-3-yl]-3-(4-phenyldiazenylphenyl)urea (PubChem CID 95354595) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-[(3S)-1-methylpiperidin-3-yl]-3-(4-phenyldiazenylphenyl)urea.
| Compound Name | 1-[(3S)-1-methylpiperidin-3-yl]-3-(4-phenyldiazenylphenyl)urea |
|---|---|
| PubChem CID | 95354595 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-[(3S)-1-methylpiperidin-3-yl]-3-(4-phenyldiazenylphenyl)urea |
| SMILES | CN1CCC[C@H](NC(=O)Nc2ccc(/N=N/c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C19H23N5O/c1-24-13-5-8-18(14-24)21-19(25)20-15-9-11-17(12-10-15)23-22-16-6-3-2-4-7-16/h2-4,6-7,9-12,18H,5,8,13-14H2,1H3,(H2,20,21,25)/b23-22+/t18-/m0/s1 |
| InChIKey | ZCSYDWLTHVOBJU-CCWVLBSLSA-N |
| XLogP | 4.32 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|