C12H15F3N2 — CID 95359026
(2S,3S)-1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 95359026) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is (2S,3S)-1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | (2S,3S)-1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 95359026 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (2S,3S)-1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | CCN1CC[C@H](N)[C@@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H15F3N2/c1-2-17-4-3-10(16)12(17)7-5-8(13)11(15)9(14)6-7/h5-6,10,12H,2-4,16H2,1H3/t10-,12-/m0/s1 |
| InChIKey | XNDXBESKWCDSDL-JQWIXIFHSA-N |
| XLogP | 2.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|