C15H17ClN4 — CID 95361082
(3R)-1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-3-amine (PubChem CID 95361082) has the molecular formula C15H17ClN4 and a molecular weight of 288.78 g/mol. Its IUPAC name is (3R)-1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-3-amine.
| Compound Name | (3R)-1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 95361082 |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (3R)-1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-3-amine |
| SMILES | N[C@@H]1CCCN(c2ccc(-c3ccccc3Cl)nn2)C1 |
| InChI | InChI=1S/C15H17ClN4/c16-13-6-2-1-5-12(13)14-7-8-15(19-18-14)20-9-3-4-11(17)10-20/h1-2,5-8,11H,3-4,9-10,17H2/t11-/m1/s1 |
| InChIKey | HDWMSUPKAQVECL-LLVKDONJSA-N |
| XLogP | 2.72 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |