C8H13N3 — CID 95366500
3-methyl-1-[(3S)-pyrrolidin-3-yl]pyrazole (PubChem CID 95366500) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-methyl-1-[(3S)-pyrrolidin-3-yl]pyrazole.
| Compound Name | 3-methyl-1-[(3S)-pyrrolidin-3-yl]pyrazole |
|---|---|
| PubChem CID | 95366500 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 3-methyl-1-[(3S)-pyrrolidin-3-yl]pyrazole |
| SMILES | Cc1ccn([C@H]2CCNC2)n1 |
| InChI | InChI=1S/C8H13N3/c1-7-3-5-11(10-7)8-2-4-9-6-8/h3,5,8-9H,2,4,6H2,1H3/t8-/m0/s1 |
| InChIKey | DQLIGRKVYDXESJ-QMMMGPOBSA-N |
| XLogP | 0.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |