C19H23NO3 — CID 95367999
N-[(2R)-2-hydroxy-2-phenylpropyl]-4-propan-2-yloxybenzamide (PubChem CID 95367999) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-phenylpropyl]-4-propan-2-yloxybenzamide.
| Compound Name | N-[(2R)-2-hydroxy-2-phenylpropyl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 95367999 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-phenylpropyl]-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)NC[C@](C)(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-14(2)23-17-11-9-15(10-12-17)18(21)20-13-19(3,22)16-7-5-4-6-8-16/h4-12,14,22H,13H2,1-3H3,(H,20,21)/t19-/m0/s1 |
| InChIKey | VZSIGOXSPQPFLS-IBGZPJMESA-N |
| XLogP | 3.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |