C9H19NO — CID 95368704
cis-(1R,3S)-N-(2-methoxyethyl)-3-methylcyclopentan-1-amine (PubChem CID 95368704) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is cis-(1R,3S)-N-(2-methoxyethyl)-3-methylcyclopentan-1-amine.
| Compound Name | cis-(1R,3S)-N-(2-methoxyethyl)-3-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 95368704 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | cis-(1R,3S)-N-(2-methoxyethyl)-3-methylcyclopentan-1-amine |
| SMILES | COCCN[C@@H]1CC[C@H](C)C1 |
| InChI | InChI=1S/C9H19NO/c1-8-3-4-9(7-8)10-5-6-11-2/h8-10H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | UKTBJVVCFQRSAE-DTWKUNHWSA-N |
| XLogP | 1.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|