C33H31N3O7 — CID 95374530
(2R)-2-[(16,17-dimethoxy-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-5-yl)oxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 95374530) has the molecular formula C33H31N3O7 and a molecular weight of 581.63 g/mol. Its IUPAC name is (2R)-2-[(16,17-dimethoxy-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-5-yl)oxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-[(16,17-dimethoxy-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-5-yl)oxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 95374530 |
| Molecular Formula | C33H31N3O7 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | (2R)-2-[(16,17-dimethoxy-19-oxo-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13(18),14,16-nonaen-5-yl)oxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H](C)Oc2ccc3c(c2)c2ccnc4c5ccc(OC)c(OC)c5c(=O)n3c24)cc1OC |
| InChI | InChI=1S/C33H31N3O7/c1-18(32(37)35-14-12-19-6-10-25(39-2)27(16-19)41-4)43-20-7-9-24-23(17-20)21-13-15-34-29-22-8-11-26(40-3)31(42-5)28(22)33(38)36(24)30(21)29/h6-11,13,15-18H,12,14H2,1-5H3,(H,35,37)/t18-/m1/s1 |
| InChIKey | YNXUUGHFHGXAPY-GOSISDBHSA-N |
| XLogP | 4.75 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|