About (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one
(3S)-3-(3,4-difluorophenyl)cyclopentan-1-one (PubChem CID 95375871) has the molecular formula C11H10F2O
and a molecular weight of 196.20 g/mol. Its IUPAC name is (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one.
Molecular Properties
| Compound Name | (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one |
| PubChem CID | 95375871 |
| Molecular Formula | C11H10F2O |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one |
| SMILES | O=C1CC[C@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C11H10F2O/c12-10-4-2-8(6-11(10)13)7-1-3-9(14)5-7/h2,4,6-7H,1,3,5H2/t7-/m0/s1 |
| InChIKey | PDXINQUXFQHTGZ-ZETCQYMHSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one?
The IUPAC name of (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one (CID 95375871) is (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one.
What is the SMILES notation for (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one?
The canonical SMILES for (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one is O=C1CC[C@H](c2ccc(F)c(F)c2)C1.
What is the InChIKey of (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one?
The InChIKey is PDXINQUXFQHTGZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H10F2O/c12-10-4-2-8(6-11(10)13)7-1-3-9(14)5-7/h2,4,6-7H,1,3,5H2/t7-/m0/s1.
What are the key properties of (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one?
(3S)-3-(3,4-difluorophenyl)cyclopentan-1-one has a molecular weight of 196.20 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(3,4-difluorophenyl)cyclopentan-1-one is sourced from PubChem (CID 95375871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).