C12H23N — CID 95376125
N-[(1R,3R)-3-methylcyclopentyl]cyclohexanamine (PubChem CID 95376125) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-[(1R,3R)-3-methylcyclopentyl]cyclohexanamine.
| Compound Name | N-[(1R,3R)-3-methylcyclopentyl]cyclohexanamine |
|---|---|
| PubChem CID | 95376125 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-[(1R,3R)-3-methylcyclopentyl]cyclohexanamine |
| SMILES | C[C@@H]1CC[C@@H](NC2CCCCC2)C1 |
| InChI | InChI=1S/C12H23N/c1-10-7-8-12(9-10)13-11-5-3-2-4-6-11/h10-13H,2-9H2,1H3/t10-,12-/m1/s1 |
| InChIKey | LHPRWZXJRYIQLK-ZYHUDNBSSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |