C14H21N — CID 95377362
cis-(1R,2S)-2-methyl-N-[(1S)-1-phenylethyl]cyclopentan-1-amine (PubChem CID 95377362) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is cis-(1R,2S)-2-methyl-N-[(1S)-1-phenylethyl]cyclopentan-1-amine.
| Compound Name | cis-(1R,2S)-2-methyl-N-[(1S)-1-phenylethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 95377362 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | cis-(1R,2S)-2-methyl-N-[(1S)-1-phenylethyl]cyclopentan-1-amine |
| SMILES | C[C@H](N[C@@H]1CCC[C@@H]1C)c1ccccc1 |
| InChI | InChI=1S/C14H21N/c1-11-7-6-10-14(11)15-12(2)13-8-4-3-5-9-13/h3-5,8-9,11-12,14-15H,6-7,10H2,1-2H3/t11-,12-,14+/m0/s1 |
| InChIKey | PQQUQFYXUGPQNP-SGMGOOAPSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |