C18H32N4O — CID 95377906
1-tert-butyl-5-propan-2-yl-N-[(3R)-1-propan-2-ylpyrrolidin-3-yl]pyrazole-3-carboxamide (PubChem CID 95377906) has the molecular formula C18H32N4O and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-tert-butyl-5-propan-2-yl-N-[(3R)-1-propan-2-ylpyrrolidin-3-yl]pyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-5-propan-2-yl-N-[(3R)-1-propan-2-ylpyrrolidin-3-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 95377906 |
| Molecular Formula | C18H32N4O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 1-tert-butyl-5-propan-2-yl-N-[(3R)-1-propan-2-ylpyrrolidin-3-yl]pyrazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)N[C@@H]2CCN(C(C)C)C2)nn1C(C)(C)C |
| InChI | InChI=1S/C18H32N4O/c1-12(2)16-10-15(20-22(16)18(5,6)7)17(23)19-14-8-9-21(11-14)13(3)4/h10,12-14H,8-9,11H2,1-7H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | VSAIETLKJFHJIA-CQSZACIVSA-N |
| XLogP | 2.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |