C9H9ClN6O — CID 953792
2-chloro-N-(2-ethyltetrazol-5-yl)pyridine-3-carboxamide (PubChem CID 953792) has the molecular formula C9H9ClN6O and a molecular weight of 252.66 g/mol. Its IUPAC name is 2-chloro-N-(2-ethyltetrazol-5-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(2-ethyltetrazol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 953792 |
| Molecular Formula | C9H9ClN6O |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-chloro-N-(2-ethyltetrazol-5-yl)pyridine-3-carboxamide |
| SMILES | CCn1nnc(NC(=O)c2cccnc2Cl)n1 |
| InChI | InChI=1S/C9H9ClN6O/c1-2-16-14-9(13-15-16)12-8(17)6-4-3-5-11-7(6)10/h3-5H,2H2,1H3,(H,12,14,17) |
| InChIKey | ZRUAKNXGWBDFFI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|